C27H27F3N2O5S2 — CID 155268695
[3,5-dimethyl-4-[[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 155268695) has the molecular formula C27H27F3N2O5S2 and a molecular weight of 580.65 g/mol. Its IUPAC name is [3,5-dimethyl-4-[[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-4-[[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155268695 |
| Molecular Formula | C27H27F3N2O5S2 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | [3,5-dimethyl-4-[[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(C)C)c3nc(Cc4c(C)cc(OS(=O)(=O)C(F)(F)F)cc4C)ccc32)cc1 |
| InChI | InChI=1S/C27H27F3N2O5S2/c1-16(2)24-15-32(38(33,34)22-9-6-17(3)7-10-22)25-11-8-20(31-26(24)25)14-23-18(4)12-21(13-19(23)5)37-39(35,36)27(28,29)30/h6-13,15-16H,14H2,1-5H3 |
| InChIKey | WWQNZQHQFPZGRH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|