C17H12Cl2F2N6O4 — CID 155268787
6-amino-2-[3,5-dichloro-4-[[5-(3,3-difluorocyclobutyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 155268787) has the molecular formula C17H12Cl2F2N6O4 and a molecular weight of 473.22 g/mol. Its IUPAC name is 6-amino-2-[3,5-dichloro-4-[[5-(3,3-difluorocyclobutyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 6-amino-2-[3,5-dichloro-4-[[5-(3,3-difluorocyclobutyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 155268787 |
| Molecular Formula | C17H12Cl2F2N6O4 |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 6-amino-2-[3,5-dichloro-4-[[5-(3,3-difluorocyclobutyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | Nc1nn(-c2cc(Cl)c(Oc3cc(C4CC(F)(F)C4)c(=O)[nH]n3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H12Cl2F2N6O4/c18-9-1-7(27-16(30)23-15(29)13(22)26-27)2-10(19)12(9)31-11-3-8(14(28)25-24-11)6-4-17(20,21)5-6/h1-3,6H,4-5H2,(H2,22,26)(H,25,28)(H,23,29,30) |
| InChIKey | GVAZHBXTIKSYSN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |