C28H23Cl2N5O6S — CID 155268856
[(2Z)-2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-propylindol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid (PubChem CID 155268856) has the molecular formula C28H23Cl2N5O6S and a molecular weight of 628.49 g/mol. Its IUPAC name is [(2Z)-2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-propylindol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid.
| Compound Name | [(2Z)-2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-propylindol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid |
|---|---|
| PubChem CID | 155268856 |
| Molecular Formula | C28H23Cl2N5O6S |
| Molecular Weight | 628.49 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | [(2Z)-2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-propylindol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid |
| SMILES | CCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccc(Oc3c(Cl)cc(N/N=C(/C#N)C(=O)NC(=O)O)cc3Cl)cc12 |
| InChI | InChI=1S/C28H23Cl2N5O6S/c1-3-4-17-15-35(42(39,40)20-8-5-16(2)6-9-20)25-10-7-19(13-21(17)25)41-26-22(29)11-18(12-23(26)30)33-34-24(14-31)27(36)32-28(37)38/h5-13,15,33H,3-4H2,1-2H3,(H,32,36)(H,37,38)/b34-24- |
| InChIKey | JCIYEGHZCWKUNJ-BCJTWVECSA-N |
| XLogP | 6.32 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|