About 8aH-chromen-2-ol
8aH-chromen-2-ol (PubChem CID 155269176) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 8aH-chromen-2-ol.
Molecular Properties
| Compound Name | 8aH-chromen-2-ol |
| PubChem CID | 155269176 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 8aH-chromen-2-ol |
| SMILES | OC1=CC=C2C=CC=CC2O1 |
| InChI | InChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,8,10H |
| InChIKey | NBDXVOLZYUXMJU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8aH-chromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-chromen-2-ol?
The IUPAC name of 8aH-chromen-2-ol (CID 155269176) is 8aH-chromen-2-ol.
What is the SMILES notation for 8aH-chromen-2-ol?
The canonical SMILES for 8aH-chromen-2-ol is OC1=CC=C2C=CC=CC2O1.
What is the InChIKey of 8aH-chromen-2-ol?
The InChIKey is NBDXVOLZYUXMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,8,10H.
What are the key properties of 8aH-chromen-2-ol?
8aH-chromen-2-ol has a molecular weight of 148.16 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-chromen-2-ol is sourced from PubChem (CID 155269176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).