C20H12Cl2F3N3OS — CID 155269219
N-[(3,4-dichlorophenyl)methoxy]-1-[6-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanimine (PubChem CID 155269219) has the molecular formula C20H12Cl2F3N3OS and a molecular weight of 470.30 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methoxy]-1-[6-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanimine.
| Compound Name | N-[(3,4-dichlorophenyl)methoxy]-1-[6-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155269219 |
| Molecular Formula | C20H12Cl2F3N3OS |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methoxy]-1-[6-[4-(trifluoromethyl)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]methanimine |
| SMILES | FC(F)(F)c1ccc(-c2nc3sccn3c2C=NOCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H12Cl2F3N3OS/c21-15-6-1-12(9-16(15)22)11-29-26-10-17-18(27-19-28(17)7-8-30-19)13-2-4-14(5-3-13)20(23,24)25/h1-10H,11H2 |
| InChIKey | IOYLGJPLAFEWGR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|