C22H18ClNS2 — CID 155269249
8-chloro-17-(2,2-dimethylpropyl)-10,20-dithia-7-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene (PubChem CID 155269249) has the molecular formula C22H18ClNS2 and a molecular weight of 395.98 g/mol. Its IUPAC name is 8-chloro-17-(2,2-dimethylpropyl)-10,20-dithia-7-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene.
| Compound Name | 8-chloro-17-(2,2-dimethylpropyl)-10,20-dithia-7-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 155269249 |
| Molecular Formula | C22H18ClNS2 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 8-chloro-17-(2,2-dimethylpropyl)-10,20-dithia-7-azapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1,3(11),4(9),5,7,12,14(19),15,17-nonaene |
| SMILES | CC(C)(C)Cc1ccc2c(c1)sc1cc3c(cc12)sc1c(Cl)nccc13 |
| InChI | InChI=1S/C22H18ClNS2/c1-22(2,3)11-12-4-5-13-15-9-19-16(10-18(15)25-17(13)8-12)14-6-7-24-21(23)20(14)26-19/h4-10H,11H2,1-3H3 |
| InChIKey | VFYALZWDSLHZLF-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|