C27H36F3N7O2 — CID 155269610
4-[3-[[2-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 155269610) has the molecular formula C27H36F3N7O2 and a molecular weight of 547.63 g/mol. Its IUPAC name is 4-[3-[[2-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[2-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 155269610 |
| Molecular Formula | C27H36F3N7O2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 4-[3-[[2-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | CCc1cc(N2C[C@H]3CC[C@@H](C2)N3)ccc1Nc1ncc(C(F)(F)F)c(NCCCN2CCOCCC2=O)n1 |
| InChI | InChI=1S/C27H36F3N7O2/c1-2-18-14-21(37-16-19-4-5-20(17-37)33-19)6-7-23(18)34-26-32-15-22(27(28,29)30)25(35-26)31-9-3-10-36-11-13-39-12-8-24(36)38/h6-7,14-15,19-20,33H,2-5,8-13,16-17H2,1H3,(H2,31,32,34,35)/t19-,20+ |
| InChIKey | GJTCEEQWDPSDLY-BGYRXZFFSA-N |
| XLogP | 3.79 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|