C30H43F2N7O2 — CID 155269658
4-[3-[[5-(difluoromethyl)-2-[2-ethyl-4-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]pyrimidin-4-yl]amino]propyl]-6,6-dimethyl-1,4-oxazepan-5-one (PubChem CID 155269658) has the molecular formula C30H43F2N7O2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 4-[3-[[5-(difluoromethyl)-2-[2-ethyl-4-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]pyrimidin-4-yl]amino]propyl]-6,6-dimethyl-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[5-(difluoromethyl)-2-[2-ethyl-4-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]pyrimidin-4-yl]amino]propyl]-6,6-dimethyl-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 155269658 |
| Molecular Formula | C30H43F2N7O2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | 4-[3-[[5-(difluoromethyl)-2-[2-ethyl-4-[(1R,5S)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]pyrimidin-4-yl]amino]propyl]-6,6-dimethyl-1,4-oxazepan-5-one |
| SMILES | CCc1cc(N2C[C@H]3CC[C@@H](C2)N3C)ccc1Nc1ncc(C(F)F)c(NCCCN2CCOCC(C)(C)C2=O)n1 |
| InChI | InChI=1S/C30H43F2N7O2/c1-5-20-15-21(39-17-22-7-8-23(18-39)37(22)4)9-10-25(20)35-29-34-16-24(26(31)32)27(36-29)33-11-6-12-38-13-14-41-19-30(2,3)28(38)40/h9-10,15-16,22-23,26H,5-8,11-14,17-19H2,1-4H3,(H2,33,34,35,36)/t22-,23+ |
| InChIKey | WULLAOAXCGUTIR-ZRZAMGCNSA-N |
| XLogP | 4.69 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|