C29H38F3N7O2 — CID 155269703
4-[3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopropylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 155269703) has the molecular formula C29H38F3N7O2 and a molecular weight of 573.66 g/mol. Its IUPAC name is 4-[3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopropylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 4-[3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopropylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 155269703 |
| Molecular Formula | C29H38F3N7O2 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 4-[3-[[2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-cyclopropylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | O=C1CCOCCN1CCCNc1nc(Nc2ccc(N3CCN4CCCC4C3)cc2C2CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C29H38F3N7O2/c30-29(31,32)24-18-34-28(36-27(24)33-9-2-11-38-14-16-41-15-8-26(38)40)35-25-7-6-21(17-23(25)20-4-5-20)39-13-12-37-10-1-3-22(37)19-39/h6-7,17-18,20,22H,1-5,8-16,19H2,(H2,33,34,35,36) |
| InChIKey | YBORTFAHOSEYGL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|