C26H33F3N6O3 — CID 155269922
4-[3-[[2-(2-cyclopropyl-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one (PubChem CID 155269922) has the molecular formula C26H33F3N6O3 and a molecular weight of 534.58 g/mol. Its IUPAC name is 4-[3-[[2-(2-cyclopropyl-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one.
| Compound Name | 4-[3-[[2-(2-cyclopropyl-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 155269922 |
| Molecular Formula | C26H33F3N6O3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 4-[3-[[2-(2-cyclopropyl-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
| SMILES | O=C1COCCCN1CCCNc1nc(Nc2ccc(N3CCOCC3)cc2C2CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H33F3N6O3/c27-26(28,29)21-16-31-25(33-24(21)30-7-1-8-35-9-2-12-38-17-23(35)36)32-22-6-5-19(15-20(22)18-3-4-18)34-10-13-37-14-11-34/h5-6,15-16,18H,1-4,7-14,17H2,(H2,30,31,32,33) |
| InChIKey | FSXMLPMNBPESPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|