C22H31F3N8O — CID 155270037
1-[3-[[2-[(1-piperidin-4-ylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one (PubChem CID 155270037) has the molecular formula C22H31F3N8O and a molecular weight of 480.54 g/mol. Its IUPAC name is 1-[3-[[2-[(1-piperidin-4-ylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one.
| Compound Name | 1-[3-[[2-[(1-piperidin-4-ylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one |
|---|---|
| PubChem CID | 155270037 |
| Molecular Formula | C22H31F3N8O |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 1-[3-[[2-[(1-piperidin-4-ylpyrazol-4-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCCNc1nc(Nc2cnn(C3CCNCC3)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C22H31F3N8O/c23-22(24,25)18-14-28-21(30-16-13-29-33(15-16)17-6-9-26-10-7-17)31-20(18)27-8-4-12-32-11-3-1-2-5-19(32)34/h13-15,17,26H,1-12H2,(H2,27,28,30,31) |
| InChIKey | PSWCCKCLESISMH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|