C29H48O — CID 155271188
(1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6-ethyloctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 155271188) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6-ethyloctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6-ethyloctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 155271188 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(1R,7aR)-1-[(2R)-6-ethyloctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CCCC(CC)CC |
| InChI | InChI=1S/C29H48O/c1-6-23(7-2)11-8-10-22(4)27-17-18-28-24(12-9-19-29(27,28)5)14-15-25-20-26(30)16-13-21(25)3/h14-15,22-23,26-28,30H,3,6-13,16-20H2,1-2,4-5H3/b24-14+,25-15-/t22-,26+,27-,28?,29-/m1/s1 |
| InChIKey | FYMZFHGWECYEMD-ZCEYEDOMSA-N |
| XLogP | 8.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |