C24H22FN5O4S — CID 155271380
methyl 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]benzoate (PubChem CID 155271380) has the molecular formula C24H22FN5O4S and a molecular weight of 495.54 g/mol. Its IUPAC name is methyl 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 155271380 |
| Molecular Formula | C24H22FN5O4S |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | methyl 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylphenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C2CC2)c(S(=O)(=O)Nc2cc(-c3ncnn3C)c(F)cc2-n2cccc2)c1 |
| InChI | InChI=1S/C24H22FN5O4S/c1-29-23(26-14-27-29)18-12-20(21(13-19(18)25)30-9-3-4-10-30)28-35(32,33)22-11-16(24(31)34-2)7-8-17(22)15-5-6-15/h3-4,7-15,28H,5-6H2,1-2H3 |
| InChIKey | SMAGHEJAFLKCND-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|