C22H17FN6O4S — CID 155271452
4-cyclopropyl-3-[[4-fluoro-2-pyridin-2-yl-5-(tetrazol-1-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 155271452) has the molecular formula C22H17FN6O4S and a molecular weight of 480.48 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[4-fluoro-2-pyridin-2-yl-5-(tetrazol-1-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[[4-fluoro-2-pyridin-2-yl-5-(tetrazol-1-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155271452 |
| Molecular Formula | C22H17FN6O4S |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 4-cyclopropyl-3-[[4-fluoro-2-pyridin-2-yl-5-(tetrazol-1-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CC2)c(S(=O)(=O)Nc2cc(-n3cnnn3)c(F)cc2-c2ccccn2)c1 |
| InChI | InChI=1S/C22H17FN6O4S/c23-17-10-16(18-3-1-2-8-24-18)19(11-20(17)29-12-25-27-28-29)26-34(32,33)21-9-14(22(30)31)6-7-15(21)13-4-5-13/h1-3,6-13,26H,4-5H2,(H,30,31) |
| InChIKey | DFVIMMNBIIKSMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |