C21H17F3N2O4S — CID 155271610
4-ethyl-3-[[2-pyridin-3-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 155271610) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 4-ethyl-3-[[2-pyridin-3-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-ethyl-3-[[2-pyridin-3-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155271610 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-ethyl-3-[[2-pyridin-3-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1-c1cccnc1 |
| InChI | InChI=1S/C21H17F3N2O4S/c1-2-13-5-6-14(20(27)28)10-19(13)31(29,30)26-18-11-16(21(22,23)24)7-8-17(18)15-4-3-9-25-12-15/h3-12,26H,2H2,1H3,(H,27,28) |
| InChIKey | OQHKAKYMMYMDSO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |