C12H12F2N4 — CID 155271897
(2,6-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene (PubChem CID 155271897) has the molecular formula C12H12F2N4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene.
| Compound Name | (2,6-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
|---|---|
| PubChem CID | 155271897 |
| Molecular Formula | C12H12F2N4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (2,6-difluorophenyl)-(1,3,5-trimethylpyrazol-4-yl)diazene |
| SMILES | Cc1nn(C)c(C)c1/N=N/c1c(F)cccc1F |
| InChI | InChI=1S/C12H12F2N4/c1-7-11(8(2)18(3)17-7)15-16-12-9(13)5-4-6-10(12)14/h4-6H,1-3H3/b16-15+ |
| InChIKey | XJLPMJRJBZCHIQ-FOCLMDBBSA-N |
| XLogP | 3.73 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|