C15H14O2 — CID 15527247
(4bR,9bS)-4b,6,7,8,9b,10-hexahydroindeno[1,2-b][1]benzofuran-9-one (PubChem CID 15527247) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (4bR,9bS)-4b,6,7,8,9b,10-hexahydroindeno[1,2-b][1]benzofuran-9-one.
| Compound Name | (4bR,9bS)-4b,6,7,8,9b,10-hexahydroindeno[1,2-b][1]benzofuran-9-one |
|---|---|
| PubChem CID | 15527247 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (4bR,9bS)-4b,6,7,8,9b,10-hexahydroindeno[1,2-b][1]benzofuran-9-one |
| SMILES | O=C1CCCC2=C1[C@@H]1Cc3ccccc3[C@@H]1O2 |
| InChI | InChI=1S/C15H14O2/c16-12-6-3-7-13-14(12)11-8-9-4-1-2-5-10(9)15(11)17-13/h1-2,4-5,11,15H,3,6-8H2/t11-,15-/m0/s1 |
| InChIKey | RODVBDXNYFINNP-NHYWBVRUSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |