C30H35N9O3 — CID 155272552
7-N-methyl-2-(1,3-oxazol-2-yl)-7-N-[2-[4-[4-(2-phenylmethoxyethoxy)phenyl]piperazin-1-yl]ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine (PubChem CID 155272552) has the molecular formula C30H35N9O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is 7-N-methyl-2-(1,3-oxazol-2-yl)-7-N-[2-[4-[4-(2-phenylmethoxyethoxy)phenyl]piperazin-1-yl]ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine.
| Compound Name | 7-N-methyl-2-(1,3-oxazol-2-yl)-7-N-[2-[4-[4-(2-phenylmethoxyethoxy)phenyl]piperazin-1-yl]ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 155272552 |
| Molecular Formula | C30H35N9O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 7-N-methyl-2-(1,3-oxazol-2-yl)-7-N-[2-[4-[4-(2-phenylmethoxyethoxy)phenyl]piperazin-1-yl]ethyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-diamine |
| SMILES | CN(CCN1CCN(c2ccc(OCCOCc3ccccc3)cc2)CC1)c1cc2nc(-c3ncco3)nn2c(N)n1 |
| InChI | InChI=1S/C30H35N9O3/c1-36(26-21-27-33-28(29-32-11-18-42-29)35-39(27)30(31)34-26)12-13-37-14-16-38(17-15-37)24-7-9-25(10-8-24)41-20-19-40-22-23-5-3-2-4-6-23/h2-11,18,21H,12-17,19-20,22H2,1H3,(H2,31,34) |
| InChIKey | ICUOMDMOLPEWAN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|