C25H29N9O — CID 155272731
5-methyl-6-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]cyclohexyl]-1H-benzimidazol-2-one (PubChem CID 155272731) has the molecular formula C25H29N9O and a molecular weight of 471.57 g/mol. Its IUPAC name is 5-methyl-6-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]cyclohexyl]-1H-benzimidazol-2-one.
| Compound Name | 5-methyl-6-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]cyclohexyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 155272731 |
| Molecular Formula | C25H29N9O |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 5-methyl-6-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-[4-[(1-methyl-1,2,4-triazol-3-yl)methylamino]cyclohexyl]-1H-benzimidazol-2-one |
| SMILES | Cc1cc2c(cc1-c1cc(C)c3ncnn3c1)[nH]c(=O)n2C1CCC(NCc2ncn(C)n2)CC1 |
| InChI | InChI=1S/C25H29N9O/c1-15-9-22-21(10-20(15)17-8-16(2)24-27-13-29-33(24)12-17)30-25(35)34(22)19-6-4-18(5-7-19)26-11-23-28-14-32(3)31-23/h8-10,12-14,18-19,26H,4-7,11H2,1-3H3,(H,30,35) |
| InChIKey | PQAHTGAKYZHNGY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |