C20H19F3N6O5 — CID 155272991
(3R)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-(trifluoromethyl)anilino]piperidine-1-carboxylic acid (PubChem CID 155272991) has the molecular formula C20H19F3N6O5 and a molecular weight of 480.40 g/mol. Its IUPAC name is (3R)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-(trifluoromethyl)anilino]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155272991 |
| Molecular Formula | C20H19F3N6O5 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (3R)-3-[4-(8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-nitro-5-(trifluoromethyl)anilino]piperidine-1-carboxylic acid |
| SMILES | COc1cc(-c2cc([N+](=O)[O-])c(N[C@@H]3CCCN(C(=O)O)C3)cc2C(F)(F)F)cn2ncnc12 |
| InChI | InChI=1S/C20H19F3N6O5/c1-34-17-5-11(8-28-18(17)24-10-25-28)13-6-16(29(32)33)15(7-14(13)20(21,22)23)26-12-3-2-4-27(9-12)19(30)31/h5-8,10,12,26H,2-4,9H2,1H3,(H,30,31)/t12-/m1/s1 |
| InChIKey | LXFHGJAYFCOSOQ-GFCCVEGCSA-N |
| XLogP | 3.89 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|