C19H20N2O3 — CID 155273037
3-(5-amino-1,3-dihydroisoindol-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-1-one (PubChem CID 155273037) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-1-one.
| Compound Name | 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-1-one |
|---|---|
| PubChem CID | 155273037 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(5-amino-1,3-dihydroisoindol-2-yl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-1-one |
| SMILES | Nc1ccc2c(c1)CN(CCC(=O)c1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C19H20N2O3/c20-16-3-1-14-11-21(12-15(14)9-16)6-5-17(22)13-2-4-18-19(10-13)24-8-7-23-18/h1-4,9-10H,5-8,11-12,20H2 |
| InChIKey | BVYDDHJNFVBTIT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|