About ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate
ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate (PubChem CID 15527367) has the molecular formula C21H20F2O5S
and a molecular weight of 422.45 g/mol. Its IUPAC name is ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
| PubChem CID | 15527367 |
| Molecular Formula | C21H20F2O5S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccccc1)CC(OS(=O)(=O)c1ccc(C)cc1)=C(F)F |
| InChI | InChI=1S/C21H20F2O5S/c1-3-27-21(24)17(13-16-7-5-4-6-8-16)14-19(20(22)23)28-29(25,26)18-11-9-15(2)10-12-18/h4-13H,3,14H2,1-2H3/b17-13- |
| InChIKey | SIVCCIDALTYLCQ-LGMDPLHJSA-N |
| XLogP | 4.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate?
The IUPAC name of ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate (CID 15527367) is ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate.
What is the SMILES notation for ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate?
The canonical SMILES for ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate is CCOC(=O)/C(=C\c1ccccc1)CC(OS(=O)(=O)c1ccc(C)cc1)=C(F)F.
What is the InChIKey of ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate?
The InChIKey is SIVCCIDALTYLCQ-LGMDPLHJSA-N. The full InChI is InChI=1S/C21H20F2O5S/c1-3-27-21(24)17(13-16-7-5-4-6-8-16)14-19(20(22)23)28-29(25,26)18-11-9-15(2)10-12-18/h4-13H,3,14H2,1-2H3/b17-13-.
What are the key properties of ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate?
ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate has a molecular weight of 422.45 g/mol, XLogP of 4.85, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-benzylidene-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate is sourced from PubChem (CID 15527367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).