C29H40N2 — CID 155273951
N'-[(1Z,4E,7E,9E,11Z)-8-ethenyl-4,11,12-trimethyl-1-(4-prop-2-enylcyclohex-2-en-1-yl)tetradeca-1,4,7,9,11,13-hexaenyl]methanimidamide (PubChem CID 155273951) has the molecular formula C29H40N2 and a molecular weight of 416.65 g/mol. Its IUPAC name is N'-[(1Z,4E,7E,9E,11Z)-8-ethenyl-4,11,12-trimethyl-1-(4-prop-2-enylcyclohex-2-en-1-yl)tetradeca-1,4,7,9,11,13-hexaenyl]methanimidamide.
| Compound Name | N'-[(1Z,4E,7E,9E,11Z)-8-ethenyl-4,11,12-trimethyl-1-(4-prop-2-enylcyclohex-2-en-1-yl)tetradeca-1,4,7,9,11,13-hexaenyl]methanimidamide |
|---|---|
| PubChem CID | 155273951 |
| Molecular Formula | C29H40N2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | N'-[(1Z,4E,7E,9E,11Z)-8-ethenyl-4,11,12-trimethyl-1-(4-prop-2-enylcyclohex-2-en-1-yl)tetradeca-1,4,7,9,11,13-hexaenyl]methanimidamide |
| SMILES | C=CCC1C=CC(C(=C/C/C(C)=C/C/C=C(C=C)/C=C/C(C)=C(/C)C=C)/N=C/N)CC1 |
| InChI | InChI=1S/C29H40N2/c1-7-11-27-17-19-28(20-18-27)29(31-22-30)21-14-23(4)12-10-13-26(9-3)16-15-25(6)24(5)8-2/h7-9,12-13,15-17,19,21-22,27-28H,1-3,10-11,14,18,20H2,4-6H3,(H2,30,31)/b16-15+,23-12+,25-24-,26-13+,29-21- |
| InChIKey | JPIGJMZAMVZMNK-QDPSAXQTSA-N |
| XLogP | 7.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|