C18H21N — CID 155274052
N-cyclohexa-1,3-dien-1-yl-4-[(1E,3Z)-hexa-1,3-dienyl]aniline (PubChem CID 155274052) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-4-[(1E,3Z)-hexa-1,3-dienyl]aniline.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-4-[(1E,3Z)-hexa-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 155274052 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-4-[(1E,3Z)-hexa-1,3-dienyl]aniline |
| SMILES | CC/C=C\C=C\c1ccc(NC2=CC=CCC2)cc1 |
| InChI | InChI=1S/C18H21N/c1-2-3-4-6-9-16-12-14-18(15-13-16)19-17-10-7-5-8-11-17/h3-7,9-10,12-15,19H,2,8,11H2,1H3/b4-3-,9-6+ |
| InChIKey | QEIXNALLVBXYSJ-ZNUQQGBJSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|