About [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate
[butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 155274352) has the molecular formula C15H20N2O6
and a molecular weight of 324.33 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| PubChem CID | 155274352 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | CCCC(=O)N(C=O)OC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H20N2O6/c1-2-6-14(21)17(11-18)23-15(22)7-4-3-5-10-16-12(19)8-9-13(16)20/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | MKPLTUZZJRJOLS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The IUPAC name of [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate (CID 155274352) is [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
What is the SMILES notation for [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The canonical SMILES for [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate is CCCC(=O)N(C=O)OC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The InChIKey is MKPLTUZZJRJOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O6/c1-2-6-14(21)17(11-18)23-15(22)7-4-3-5-10-16-12(19)8-9-13(16)20/h8-9,11H,2-7,10H2,1H3.
What are the key properties of [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
[butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate has a molecular weight of 324.33 g/mol, XLogP of 0.72, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [butanoyl(formyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 155274352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).