About N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine
N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine (PubChem CID 155274500) has the molecular formula C14H23F2N
and a molecular weight of 243.34 g/mol. Its IUPAC name is N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine.
Molecular Properties
| Compound Name | N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine |
| PubChem CID | 155274500 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine |
| SMILES | C=C(C)NC(=C)C1(C(C)C)CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H23F2N/c1-10(2)13(12(5)17-11(3)4)6-8-14(15,16)9-7-13/h10,17H,3,5-9H2,1-2,4H3 |
| InChIKey | IMGAFGRZIFQUHQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine?
The IUPAC name of N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine (CID 155274500) is N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine.
What is the SMILES notation for N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine?
The canonical SMILES for N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine is C=C(C)NC(=C)C1(C(C)C)CCC(F)(F)CC1.
What is the InChIKey of N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine?
The InChIKey is IMGAFGRZIFQUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F2N/c1-10(2)13(12(5)17-11(3)4)6-8-14(15,16)9-7-13/h10,17H,3,5-9H2,1-2,4H3.
What are the key properties of N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine?
N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine has a molecular weight of 243.34 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,4-difluoro-1-propan-2-ylcyclohexyl)ethenyl]prop-1-en-2-amine is sourced from PubChem (CID 155274500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).