About 1-chloro-4,4a-dihydro-2,7-naphthyridine
1-chloro-4,4a-dihydro-2,7-naphthyridine (PubChem CID 155274605) has the molecular formula C8H7ClN2
and a molecular weight of 166.61 g/mol. Its IUPAC name is 1-chloro-4,4a-dihydro-2,7-naphthyridine.
Molecular Properties
| Compound Name | 1-chloro-4,4a-dihydro-2,7-naphthyridine |
| PubChem CID | 155274605 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 1-chloro-4,4a-dihydro-2,7-naphthyridine |
| SMILES | ClC1=C2C=NC=CC2CC=N1 |
| InChI | InChI=1S/C8H7ClN2/c9-8-7-5-10-3-1-6(7)2-4-11-8/h1,3-6H,2H2 |
| InChIKey | IAMYEPLLYPXAJB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4,4a-dihydro-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4,4a-dihydro-2,7-naphthyridine?
The IUPAC name of 1-chloro-4,4a-dihydro-2,7-naphthyridine (CID 155274605) is 1-chloro-4,4a-dihydro-2,7-naphthyridine.
What is the SMILES notation for 1-chloro-4,4a-dihydro-2,7-naphthyridine?
The canonical SMILES for 1-chloro-4,4a-dihydro-2,7-naphthyridine is ClC1=C2C=NC=CC2CC=N1.
What is the InChIKey of 1-chloro-4,4a-dihydro-2,7-naphthyridine?
The InChIKey is IAMYEPLLYPXAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2/c9-8-7-5-10-3-1-6(7)2-4-11-8/h1,3-6H,2H2.
What are the key properties of 1-chloro-4,4a-dihydro-2,7-naphthyridine?
1-chloro-4,4a-dihydro-2,7-naphthyridine has a molecular weight of 166.61 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4,4a-dihydro-2,7-naphthyridine is sourced from PubChem (CID 155274605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).