About 5-chloro-6-ethyl-2,3-dihydropyrazine
5-chloro-6-ethyl-2,3-dihydropyrazine (PubChem CID 155274608) has the molecular formula C6H9ClN2
and a molecular weight of 144.60 g/mol. Its IUPAC name is 5-chloro-6-ethyl-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 5-chloro-6-ethyl-2,3-dihydropyrazine |
| PubChem CID | 155274608 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 5-chloro-6-ethyl-2,3-dihydropyrazine |
| SMILES | CCC1=NCCN=C1Cl |
| InChI | InChI=1S/C6H9ClN2/c1-2-5-6(7)9-4-3-8-5/h2-4H2,1H3 |
| InChIKey | CCZGPUNRGOROAC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-6-ethyl-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-ethyl-2,3-dihydropyrazine?
The IUPAC name of 5-chloro-6-ethyl-2,3-dihydropyrazine (CID 155274608) is 5-chloro-6-ethyl-2,3-dihydropyrazine.
What is the SMILES notation for 5-chloro-6-ethyl-2,3-dihydropyrazine?
The canonical SMILES for 5-chloro-6-ethyl-2,3-dihydropyrazine is CCC1=NCCN=C1Cl.
What is the InChIKey of 5-chloro-6-ethyl-2,3-dihydropyrazine?
The InChIKey is CCZGPUNRGOROAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c1-2-5-6(7)9-4-3-8-5/h2-4H2,1H3.
What are the key properties of 5-chloro-6-ethyl-2,3-dihydropyrazine?
5-chloro-6-ethyl-2,3-dihydropyrazine has a molecular weight of 144.60 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-ethyl-2,3-dihydropyrazine is sourced from PubChem (CID 155274608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).