About 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine
6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine (PubChem CID 155274657) has the molecular formula C18H34FN
and a molecular weight of 283.47 g/mol. Its IUPAC name is 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine |
| PubChem CID | 155274657 |
| Molecular Formula | C18H34FN |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine |
| SMILES | C=C(CC)CN(C)C(=C)C(C)CCC(C)(F)CCCC |
| InChI | InChI=1S/C18H34FN/c1-8-10-12-18(6,19)13-11-16(4)17(5)20(7)14-15(3)9-2/h16H,3,5,8-14H2,1-2,4,6-7H3 |
| InChIKey | GMLFAOCIRCFKHQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine?
The IUPAC name of 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine (CID 155274657) is 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine.
What is the SMILES notation for 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine?
The canonical SMILES for 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine is C=C(CC)CN(C)C(=C)C(C)CCC(C)(F)CCCC.
What is the InChIKey of 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine?
The InChIKey is GMLFAOCIRCFKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34FN/c1-8-10-12-18(6,19)13-11-16(4)17(5)20(7)14-15(3)9-2/h16H,3,5,8-14H2,1-2,4,6-7H3.
What are the key properties of 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine?
6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine has a molecular weight of 283.47 g/mol, XLogP of 5.73, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,3,6-trimethyl-N-(2-methylidenebutyl)dec-1-en-2-amine is sourced from PubChem (CID 155274657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).