C35H56FN3 — CID 155274676
8-N-[(3E,5E)-6-[[(2Z,4Z)-2-cyclobutylhexa-2,4-dien-3-yl]-ethylamino]-3-ethenyl-2-methylidenehepta-3,5-dienyl]-8-N-ethenyl-4-fluoro-1-N,4-dimethylnon-8-ene-1,8-diamine (PubChem CID 155274676) has the molecular formula C35H56FN3 and a molecular weight of 537.85 g/mol. Its IUPAC name is 8-N-[(3E,5E)-6-[[(2Z,4Z)-2-cyclobutylhexa-2,4-dien-3-yl]-ethylamino]-3-ethenyl-2-methylidenehepta-3,5-dienyl]-8-N-ethenyl-4-fluoro-1-N,4-dimethylnon-8-ene-1,8-diamine.
| Compound Name | 8-N-[(3E,5E)-6-[[(2Z,4Z)-2-cyclobutylhexa-2,4-dien-3-yl]-ethylamino]-3-ethenyl-2-methylidenehepta-3,5-dienyl]-8-N-ethenyl-4-fluoro-1-N,4-dimethylnon-8-ene-1,8-diamine |
|---|---|
| PubChem CID | 155274676 |
| Molecular Formula | C35H56FN3 |
| Molecular Weight | 537.85 g/mol |
| Exact Mass | 537.45 |
| IUPAC Name | 8-N-[(3E,5E)-6-[[(2Z,4Z)-2-cyclobutylhexa-2,4-dien-3-yl]-ethylamino]-3-ethenyl-2-methylidenehepta-3,5-dienyl]-8-N-ethenyl-4-fluoro-1-N,4-dimethylnon-8-ene-1,8-diamine |
| SMILES | C=C/C(=C\C=C(/C)N(CC)C(/C=C\C)=C(/C)C1CCC1)C(=C)CN(C=C)C(=C)CCCC(C)(F)CCCNC |
| InChI | InChI=1S/C35H56FN3/c1-11-18-34(31(8)33-20-15-21-33)39(14-4)30(7)22-23-32(12-2)28(5)27-38(13-3)29(6)19-16-24-35(9,36)25-17-26-37-10/h11-13,18,22-23,33,37H,2-3,5-6,14-17,19-21,24-27H2,1,4,7-10H3/b18-11-,30-22+,32-23+,34-31- |
| InChIKey | JIDUYZSVRSFTPP-WHHQKPLCSA-N |
| XLogP | 9.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.85 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|