About 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine
3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine (PubChem CID 155274720) has the molecular formula C12H22FN
and a molecular weight of 199.31 g/mol. Its IUPAC name is 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine.
Molecular Properties
| Compound Name | 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine |
| PubChem CID | 155274720 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine |
| SMILES | C=CC(=C)CCC(C)(F)CCN(C)C |
| InChI | InChI=1S/C12H22FN/c1-6-11(2)7-8-12(3,13)9-10-14(4)5/h6H,1-2,7-10H2,3-5H3 |
| InChIKey | MLTMEUQALLGDRA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine?
The IUPAC name of 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine (CID 155274720) is 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine.
What is the SMILES notation for 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine?
The canonical SMILES for 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine is C=CC(=C)CCC(C)(F)CCN(C)C.
What is the InChIKey of 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine?
The InChIKey is MLTMEUQALLGDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22FN/c1-6-11(2)7-8-12(3,13)9-10-14(4)5/h6H,1-2,7-10H2,3-5H3.
What are the key properties of 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine?
3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine has a molecular weight of 199.31 g/mol, XLogP of 3.19, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N,3-trimethyl-6-methylideneoct-7-en-1-amine is sourced from PubChem (CID 155274720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).