C22H31N5S2 — CID 155274884
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-(4-cyano-2-ethenylphenyl)sulfanylethanimidothioate (PubChem CID 155274884) has the molecular formula C22H31N5S2 and a molecular weight of 429.66 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-(4-cyano-2-ethenylphenyl)sulfanylethanimidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-(4-cyano-2-ethenylphenyl)sulfanylethanimidothioate |
|---|---|
| PubChem CID | 155274884 |
| Molecular Formula | C22H31N5S2 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-(4-cyano-2-ethenylphenyl)sulfanylethanimidothioate |
| SMILES | [H]/N=C(\S/C(CSc1ccc(C#N)cc1C=C)=N/[H])N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H31N5S2/c1-7-16-10-15(13-23)8-9-18(16)28-14-19(24)29-20(25)27(6)17-11-21(2,3)26-22(4,5)12-17/h7-10,17,24-26H,1,11-12,14H2,2-6H3/b24-19+,25-20- |
| InChIKey | NDGGELINDGUFHO-RNDVANFQSA-N |
| XLogP | 5.18 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|