C12H22FN — CID 155274989
(1E)-N-(2-fluoroethyl)-N,2,6-trimethylhepta-1,6-dien-1-amine (PubChem CID 155274989) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is (1E)-N-(2-fluoroethyl)-N,2,6-trimethylhepta-1,6-dien-1-amine.
| Compound Name | (1E)-N-(2-fluoroethyl)-N,2,6-trimethylhepta-1,6-dien-1-amine |
|---|---|
| PubChem CID | 155274989 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (1E)-N-(2-fluoroethyl)-N,2,6-trimethylhepta-1,6-dien-1-amine |
| SMILES | C=C(C)CCC/C(C)=C/N(C)CCF |
| InChI | InChI=1S/C12H22FN/c1-11(2)6-5-7-12(3)10-14(4)9-8-13/h10H,1,5-9H2,2-4H3/b12-10+ |
| InChIKey | MVYRFJLYOBFCND-ZRDIBKRKSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|