About ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate
ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate (PubChem CID 155275458) has the molecular formula C16H18N2O7
and a molecular weight of 350.33 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate.
Molecular Properties
| Compound Name | ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate |
| PubChem CID | 155275458 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate |
| SMILES | CCOC(=O)OCOC(=O)c1c(C(=O)N2CCNCC2)c2ccc1o2 |
| InChI | InChI=1S/C16H18N2O7/c1-2-22-16(21)24-9-23-15(20)13-11-4-3-10(25-11)12(13)14(19)18-7-5-17-6-8-18/h3-4,17H,2,5-9H2,1H3 |
| InChIKey | CLWYAKAJSYTCES-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate?
The IUPAC name of ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate (CID 155275458) is ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate.
What is the SMILES notation for ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate?
The canonical SMILES for ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate is CCOC(=O)OCOC(=O)c1c(C(=O)N2CCNCC2)c2ccc1o2.
What is the InChIKey of ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate?
The InChIKey is CLWYAKAJSYTCES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O7/c1-2-22-16(21)24-9-23-15(20)13-11-4-3-10(25-11)12(13)14(19)18-7-5-17-6-8-18/h3-4,17H,2,5-9H2,1H3.
What are the key properties of ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate?
ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate has a molecular weight of 350.33 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxycarbonyloxymethyl 3-(piperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2-carboxylate is sourced from PubChem (CID 155275458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).