C20H23N9 — CID 155275559
6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 155275559) has the molecular formula C20H23N9 and a molecular weight of 389.47 g/mol. Its IUPAC name is 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155275559 |
| Molecular Formula | C20H23N9 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CN(N)/C=C(\N)c1cc(-c2ccc(N3CCNCC3)nc2)c2c(C#N)cnn2c1 |
| InChI | InChI=1S/C20H23N9/c1-27(23)13-18(22)15-8-17(20-16(9-21)11-26-29(20)12-15)14-2-3-19(25-10-14)28-6-4-24-5-7-28/h2-3,8,10-13,24H,4-7,22-23H2,1H3/b18-13- |
| InChIKey | GAPXDNPMYWFBSG-AQTBWJFISA-N |
| XLogP | 0.74 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|