C33H40O6S2 — CID 155275641
4-[4-[(1S)-2-bicyclo[2.2.1]heptanyl]-2-(2-bicyclo[2.2.1]heptanyl)-6-[(4R)-2-bicyclo[2.2.1]heptanyl]phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 155275641) has the molecular formula C33H40O6S2 and a molecular weight of 596.81 g/mol. Its IUPAC name is 4-[4-[(1S)-2-bicyclo[2.2.1]heptanyl]-2-(2-bicyclo[2.2.1]heptanyl)-6-[(4R)-2-bicyclo[2.2.1]heptanyl]phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 4-[4-[(1S)-2-bicyclo[2.2.1]heptanyl]-2-(2-bicyclo[2.2.1]heptanyl)-6-[(4R)-2-bicyclo[2.2.1]heptanyl]phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 155275641 |
| Molecular Formula | C33H40O6S2 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 4-[4-[(1S)-2-bicyclo[2.2.1]heptanyl]-2-(2-bicyclo[2.2.1]heptanyl)-6-[(4R)-2-bicyclo[2.2.1]heptanyl]phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OS(=O)(=O)c2c(C3CC4CCC3C4)cc(C3CC4CC[C@H]3C4)cc2C2C[C@@H]3CCC2C3)cc1 |
| InChI | InChI=1S/C33H40O6S2/c34-40(35,36)27-9-7-26(8-10-27)39-41(37,38)33-31(29-15-20-2-5-23(29)12-20)17-25(28-14-19-1-4-22(28)11-19)18-32(33)30-16-21-3-6-24(30)13-21/h7-10,17-24,28-30H,1-6,11-16H2,(H,34,35,36)/t19?,20-,21?,22+,23?,24?,28?,29?,30?/m1/s1 |
| InChIKey | NHWLPNRCXMMELS-WDLKWFBJSA-N |
| XLogP | 7.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|