C27H42N2O2 — CID 155275652
(5Z,7Z)-2-(dimethylamino)-2-ethyl-1-[(1E,3E)-4-morpholin-4-ylcycloocta-1,3,6-trien-1-yl]undeca-5,7-dien-1-one (PubChem CID 155275652) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (5Z,7Z)-2-(dimethylamino)-2-ethyl-1-[(1E,3E)-4-morpholin-4-ylcycloocta-1,3,6-trien-1-yl]undeca-5,7-dien-1-one.
| Compound Name | (5Z,7Z)-2-(dimethylamino)-2-ethyl-1-[(1E,3E)-4-morpholin-4-ylcycloocta-1,3,6-trien-1-yl]undeca-5,7-dien-1-one |
|---|---|
| PubChem CID | 155275652 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (5Z,7Z)-2-(dimethylamino)-2-ethyl-1-[(1E,3E)-4-morpholin-4-ylcycloocta-1,3,6-trien-1-yl]undeca-5,7-dien-1-one |
| SMILES | CCC/C=C\C=C/CCC(CC)(C(=O)/C1=C/C=C(/N2CCOCC2)CC=CC1)N(C)C |
| InChI | InChI=1S/C27H42N2O2/c1-5-7-8-9-10-11-14-19-27(6-2,28(3)4)26(30)24-15-12-13-16-25(18-17-24)29-20-22-31-23-21-29/h8-13,17-18H,5-7,14-16,19-23H2,1-4H3/b9-8-,11-10-,13-12?,24-17+,25-18+ |
| InChIKey | IBXKVAPHHVUINI-UTJFRZDHSA-N |
| XLogP | 5.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|