About 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol
7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol (PubChem CID 155275797) has the molecular formula C23H28O3
and a molecular weight of 352.47 g/mol. Its IUPAC name is 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol.
Molecular Properties
| Compound Name | 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol |
| PubChem CID | 155275797 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol |
| SMILES | CCCc1cc2cc(O)cc(COc3ccc(CCC)c(C)c3C)c2o1 |
| InChI | InChI=1S/C23H28O3/c1-5-7-17-9-10-22(16(4)15(17)3)25-14-19-12-20(24)11-18-13-21(8-6-2)26-23(18)19/h9-13,24H,5-8,14H2,1-4H3 |
| InChIKey | WIMYXQPSKYVSFA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol?
The IUPAC name of 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol (CID 155275797) is 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol.
What is the SMILES notation for 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol?
The canonical SMILES for 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol is CCCc1cc2cc(O)cc(COc3ccc(CCC)c(C)c3C)c2o1.
What is the InChIKey of 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol?
The InChIKey is WIMYXQPSKYVSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O3/c1-5-7-17-9-10-22(16(4)15(17)3)25-14-19-12-20(24)11-18-13-21(8-6-2)26-23(18)19/h9-13,24H,5-8,14H2,1-4H3.
What are the key properties of 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol?
7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol has a molecular weight of 352.47 g/mol, XLogP of 6.24, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,3-dimethyl-4-propylphenoxy)methyl]-2-propyl-1-benzofuran-5-ol is sourced from PubChem (CID 155275797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).