C23H25FN4OS — CID 155275996
(1R,3S)-N-[1-cyano-2-[2-fluoro-4-[4-(methylsulfanylamino)phenyl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide (PubChem CID 155275996) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is (1R,3S)-N-[1-cyano-2-[2-fluoro-4-[4-(methylsulfanylamino)phenyl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide.
| Compound Name | (1R,3S)-N-[1-cyano-2-[2-fluoro-4-[4-(methylsulfanylamino)phenyl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 155275996 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (1R,3S)-N-[1-cyano-2-[2-fluoro-4-[4-(methylsulfanylamino)phenyl]phenyl]ethyl]-2-azabicyclo[2.2.1]heptane-3-carboxamide |
| SMILES | CSNc1ccc(-c2ccc(CC(C#N)NC(=O)[C@H]3N[C@@H]4CCC3C4)c(F)c2)cc1 |
| InChI | InChI=1S/C23H25FN4OS/c1-30-28-18-7-4-14(5-8-18)15-2-3-16(21(24)12-15)10-20(13-25)27-23(29)22-17-6-9-19(11-17)26-22/h2-5,7-8,12,17,19-20,22,26,28H,6,9-11H2,1H3,(H,27,29)/t17?,19-,20?,22+/m1/s1 |
| InChIKey | LCJVYXFGVFRWSD-LGFMMJKESA-N |
| XLogP | 3.87 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|