C26H40F6O4S2 — CID 155276330
[1,1-dicyclohexyl-3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylbut-3-enyl]cyclohexane (PubChem CID 155276330) has the molecular formula C26H40F6O4S2 and a molecular weight of 594.72 g/mol. Its IUPAC name is [1,1-dicyclohexyl-3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylbut-3-enyl]cyclohexane.
| Compound Name | [1,1-dicyclohexyl-3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylbut-3-enyl]cyclohexane |
|---|---|
| PubChem CID | 155276330 |
| Molecular Formula | C26H40F6O4S2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [1,1-dicyclohexyl-3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonylbut-3-enyl]cyclohexane |
| SMILES | C=C(CC(C1CCCCC1)(C1CCCCC1)C1CCCCC1)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(C)(=O)=O |
| InChI | InChI=1S/C26H40F6O4S2/c1-19(38(35,36)26(31,32)24(27,28)25(29,30)37(2,33)34)18-23(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h20-22H,1,3-18H2,2H3 |
| InChIKey | YJWLSJORWCBFPP-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|