C12H15F2NO — CID 155276570
N-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-1-methylcyclopropane-1-carboxamide (PubChem CID 155276570) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is N-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 155276570 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C=C(/C=C\C(F)=C(/C)F)NC(=O)C1(C)CC1 |
| InChI | InChI=1S/C12H15F2NO/c1-8(4-5-10(14)9(2)13)15-11(16)12(3)6-7-12/h4-5H,1,6-7H2,2-3H3,(H,15,16)/b5-4-,10-9- |
| InChIKey | OVKPFRWSEGGODX-ACHWKMRWSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|