About 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine
1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine (PubChem CID 155276622) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine |
| PubChem CID | 155276622 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine |
| SMILES | C=C(CC)OCC(NC)C(C)C |
| InChI | InChI=1S/C10H21NO/c1-6-9(4)12-7-10(11-5)8(2)3/h8,10-11H,4,6-7H2,1-3,5H3 |
| InChIKey | QGYBADBOCUMSMD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine?
The IUPAC name of 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine (CID 155276622) is 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine.
What is the SMILES notation for 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine?
The canonical SMILES for 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine is C=C(CC)OCC(NC)C(C)C.
What is the InChIKey of 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine?
The InChIKey is QGYBADBOCUMSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-6-9(4)12-7-10(11-5)8(2)3/h8,10-11H,4,6-7H2,1-3,5H3.
What are the key properties of 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine?
1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine has a molecular weight of 171.28 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yloxy-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 155276622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).