C13H13F3N2O6 — CID 155276707
[methyl(4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate (PubChem CID 155276707) has the molecular formula C13H13F3N2O6 and a molecular weight of 350.25 g/mol. Its IUPAC name is [methyl(4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate.
| Compound Name | [methyl(4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 155276707 |
| Molecular Formula | C13H13F3N2O6 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [methyl(4-oxobutanoyl)amino] 3-(2,5-dioxopyrrol-1-yl)-4,4,4-trifluorobutanoate |
| SMILES | CN(OC(=O)CC(N1C(=O)C=CC1=O)C(F)(F)F)C(=O)CCC=O |
| InChI | InChI=1S/C13H13F3N2O6/c1-17(9(20)3-2-6-19)24-12(23)7-8(13(14,15)16)18-10(21)4-5-11(18)22/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | DZPBOLBJQPFEKF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|