C19H18Cl2F2N6O4 — CID 155276740
[4-(6-amino-3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4S)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate (PubChem CID 155276740) has the molecular formula C19H18Cl2F2N6O4 and a molecular weight of 503.29 g/mol. Its IUPAC name is [4-(6-amino-3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4S)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate.
| Compound Name | [4-(6-amino-3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4S)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate |
|---|---|
| PubChem CID | 155276740 |
| Molecular Formula | C19H18Cl2F2N6O4 |
| Molecular Weight | 503.29 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | [4-(6-amino-3,5-dioxo-1,2,4-triazin-2-yl)-2,6-dichlorophenyl] (Z,4S)-3-carbamoyl-4-(3,3-difluorocyclobutyl)pent-2-enimidate |
| SMILES | [H]/N=C(\C=C(/C(N)=O)[C@@H](C)C1CC(F)(F)C1)Oc1c(Cl)cc(-n2nc(N)c(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C19H18Cl2F2N6O4/c1-7(8-5-19(22,23)6-8)10(16(26)30)4-13(24)33-14-11(20)2-9(3-12(14)21)29-18(32)27-17(31)15(25)28-29/h2-4,7-8,24H,5-6H2,1H3,(H2,25,28)(H2,26,30)(H,27,31,32)/b10-4-,24-13+/t7-/m0/s1 |
| InChIKey | VPBJUXCCBXDXGG-UHNKRISDSA-N |
| XLogP | 2.26 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|