C20H20F3IN2O3S2 — CID 155276743
[4-[(1-iodosulfanyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl)methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate (PubChem CID 155276743) has the molecular formula C20H20F3IN2O3S2 and a molecular weight of 584.42 g/mol. Its IUPAC name is [4-[(1-iodosulfanyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl)methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1-iodosulfanyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl)methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155276743 |
| Molecular Formula | C20H20F3IN2O3S2 |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 583.99 |
| IUPAC Name | [4-[(1-iodosulfanyl-3-propan-2-ylpyrrolo[3,2-b]pyridin-5-yl)methyl]-3,5-dimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1Cc1ccc2c(n1)c(C(C)C)cn2SI |
| InChI | InChI=1S/C20H20F3IN2O3S2/c1-11(2)17-10-26(30-24)18-6-5-14(25-19(17)18)9-16-12(3)7-15(8-13(16)4)29-31(27,28)20(21,22)23/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | WNOXQBYZRUTXOL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|