C20H20F6N6O3 — CID 155277160
(2S,3S,5S)-2,5-dimethyl-1-[2-oxo-2-[[3,3,3-trifluoro-1-(2H-triazol-4-yl)propyl]amino]acetyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 155277160) has the molecular formula C20H20F6N6O3 and a molecular weight of 506.41 g/mol. Its IUPAC name is (2S,3S,5S)-2,5-dimethyl-1-[2-oxo-2-[[3,3,3-trifluoro-1-(2H-triazol-4-yl)propyl]amino]acetyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-2,5-dimethyl-1-[2-oxo-2-[[3,3,3-trifluoro-1-(2H-triazol-4-yl)propyl]amino]acetyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155277160 |
| Molecular Formula | C20H20F6N6O3 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (2S,3S,5S)-2,5-dimethyl-1-[2-oxo-2-[[3,3,3-trifluoro-1-(2H-triazol-4-yl)propyl]amino]acetyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | C[C@H]1C[C@H](C(=O)Nc2cc(F)c(F)c(F)c2)[C@H](C)N1C(=O)C(=O)NC(CC(F)(F)F)c1cn[nH]n1 |
| InChI | InChI=1S/C20H20F6N6O3/c1-8-3-11(17(33)28-10-4-12(21)16(23)13(22)5-10)9(2)32(8)19(35)18(34)29-14(6-20(24,25)26)15-7-27-31-30-15/h4-5,7-9,11,14H,3,6H2,1-2H3,(H,28,33)(H,29,34)(H,27,30,31)/t8-,9-,11-,14?/m0/s1 |
| InChIKey | BBNCZMLFWAYIIT-HOGPLWMGSA-N |
| XLogP | 2.60 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|