C23H29FN10O10 — CID 155277396
1-[[6-[4-[2-[[5-amino-2-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]-methylamino]ethyl]piperazin-1-yl]-5-fluoro-3-pyridinyl]oxy]-2-(trihydroxymethoxy)ethane-1,1,2,2-tetrol (PubChem CID 155277396) has the molecular formula C23H29FN10O10 and a molecular weight of 624.54 g/mol. Its IUPAC name is 1-[[6-[4-[2-[[5-amino-2-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]-methylamino]ethyl]piperazin-1-yl]-5-fluoro-3-pyridinyl]oxy]-2-(trihydroxymethoxy)ethane-1,1,2,2-tetrol.
| Compound Name | 1-[[6-[4-[2-[[5-amino-2-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]-methylamino]ethyl]piperazin-1-yl]-5-fluoro-3-pyridinyl]oxy]-2-(trihydroxymethoxy)ethane-1,1,2,2-tetrol |
|---|---|
| PubChem CID | 155277396 |
| Molecular Formula | C23H29FN10O10 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 1-[[6-[4-[2-[[5-amino-2-(1,3-oxazol-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]-methylamino]ethyl]piperazin-1-yl]-5-fluoro-3-pyridinyl]oxy]-2-(trihydroxymethoxy)ethane-1,1,2,2-tetrol |
| SMILES | CN(CCN1CCN(c2ncc(OC(O)(O)C(O)(O)OC(O)(O)O)cc2F)CC1)c1cc2nc(-c3ncco3)nn2c(N)n1 |
| InChI | InChI=1S/C23H29FN10O10/c1-31(15-11-16-28-17(19-26-2-9-42-19)30-34(16)20(25)29-15)3-4-32-5-7-33(8-6-32)18-14(24)10-13(12-27-18)43-21(35,36)22(37,38)44-23(39,40)41/h2,9-12,35-41H,3-8H2,1H3,(H2,25,29) |
| InChIKey | SGXIRZCUKXRTIJ-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 277.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|