About 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine
8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine (PubChem CID 155278172) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine.
Molecular Properties
| Compound Name | 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine |
| PubChem CID | 155278172 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine |
| SMILES | CC(C)(C)CN1C=CN2C=CC=C(C(C)(C)C)N21 |
| InChI | InChI=1S/C15H25N3/c1-14(2,3)12-17-11-10-16-9-7-8-13(18(16)17)15(4,5)6/h7-11H,12H2,1-6H3 |
| InChIKey | AFCKDEJVEIQYOS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine?
The IUPAC name of 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine (CID 155278172) is 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine.
What is the SMILES notation for 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine?
The canonical SMILES for 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine is CC(C)(C)CN1C=CN2C=CC=C(C(C)(C)C)N21.
What is the InChIKey of 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine?
The InChIKey is AFCKDEJVEIQYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3/c1-14(2,3)12-17-11-10-16-9-7-8-13(18(16)17)15(4,5)6/h7-11H,12H2,1-6H3.
What are the key properties of 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine?
8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine has a molecular weight of 247.39 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-1-(2,2-dimethylpropyl)triazolo[1,2-a]pyridazine is sourced from PubChem (CID 155278172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).