C31H49NO2 — CID 155278501
(4R)-1-(4,4-dimethylpiperidin-1-yl)-4-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one (PubChem CID 155278501) has the molecular formula C31H49NO2 and a molecular weight of 467.74 g/mol. Its IUPAC name is (4R)-1-(4,4-dimethylpiperidin-1-yl)-4-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one.
| Compound Name | (4R)-1-(4,4-dimethylpiperidin-1-yl)-4-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
|---|---|
| PubChem CID | 155278501 |
| Molecular Formula | C31H49NO2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | (4R)-1-(4,4-dimethylpiperidin-1-yl)-4-[(3S,8R,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
| SMILES | C[C@H](CCC(=O)N1CCC(C)(C)CC1)[C@H]1C=C[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H49NO2/c1-21(6-11-28(34)32-18-16-29(2,3)17-19-32)25-9-10-26-24-8-7-22-20-23(33)12-14-30(22,4)27(24)13-15-31(25,26)5/h7,9-10,21,23-27,33H,6,8,11-20H2,1-5H3/t21-,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | OUOJJSCTRWXYPF-MIXBDBMTSA-N |
| XLogP | 6.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|