C35H38F2N4O5S — CID 155278744
N-(3,4-difluorophenyl)-1-[[2-[2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)propyl]-5-methylcyclopentyl]sulfamoyl]-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 155278744) has the molecular formula C35H38F2N4O5S and a molecular weight of 664.78 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-[[2-[2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)propyl]-5-methylcyclopentyl]sulfamoyl]-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-[[2-[2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)propyl]-5-methylcyclopentyl]sulfamoyl]-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 155278744 |
| Molecular Formula | C35H38F2N4O5S |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-[[2-[2-hydroxy-2-(5-phenyl-1,2-oxazol-3-yl)propyl]-5-methylcyclopentyl]sulfamoyl]-2-methyl-6,7-dihydro-5H-pyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | Cc1c(S(=O)(=O)NC2C(C)CCC2CC(C)(O)c2cc(-c3ccccc3)on2)c2n(c1C(=O)Nc1ccc(F)c(F)c1)CCCC=C2 |
| InChI | InChI=1S/C35H38F2N4O5S/c1-21-13-14-24(20-35(3,43)30-19-29(46-39-30)23-10-6-4-7-11-23)31(21)40-47(44,45)33-22(2)32(41-17-9-5-8-12-28(33)41)34(42)38-25-15-16-26(36)27(37)18-25/h4,6-8,10-12,15-16,18-19,21,24,31,40,43H,5,9,13-14,17,20H2,1-3H3,(H,38,42) |
| InChIKey | QXOAVVJDVLLGDW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |